2-(2,3,6-trifluorophenyl)acetic acid
2,3,6-(trifluorophenyl)acetic acid
CAS: 114152-23-7
Molecular Formula: C8H5F3O2
2-(2,3,6-trifluorophenyl)acetic acid - Names and Identifiers
| Name | 2,3,6-(trifluorophenyl)acetic acid |
| Synonyms | RARECHEM AL BO 0509 2,3,6-Trifluorophenylaceitc acid 2,3,6-TRIFLUOROPHENYLACETIC ACID 2,3,6-Trifluorophenylacetic acid 2,3,6-(trifluorophenyl)acetic acid Benzeneacetic acid,2,3,6-trifluoro- 2-(2,3,6-trifluorophenyl)acetic acid (2,3,6-Trifluorophenyl)acetic acid, 2-(2,3,6-Trifluorophenyl)ethanoic acid |
| CAS | 114152-23-7 |
| InChI | InChI=1/C8H5F3O2/c9-5-1-2-6(10)8(11)4(5)3-7(12)13/h1-2H,3H2,(H,12,13) |
2-(2,3,6-trifluorophenyl)acetic acid - Physico-chemical Properties
| Molecular Formula | C8H5F3O2 |
| Molar Mass | 190.12 |
| Density | 1.468±0.06 g/cm3(Predicted) |
| Melting Point | 111-114°C(lit.) |
| Boling Point | 249.5±35.0 °C(Predicted) |
| Flash Point | 104.7°C |
| Vapor Presure | 0.012mmHg at 25°C |
| Appearance | White powder or crystal |
| Color | White to slightly yellow |
| pKa | 3.53±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.488 |
| MDL | MFCD00061217 |
2-(2,3,6-trifluorophenyl)acetic acid - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| HS Code | 29163900 |
| Hazard Class | IRRITANT |
2-(2,3,6-trifluorophenyl)acetic acid - Introduction
2,3, 6-Trifluorophenylacetic acid is an organic compound with the chemical formula C8H5F3O2, often abbreviated as TFBA. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: Colorless or yellow crystalline solid.
2. melting point: about 50-53 degrees Celsius.
3. Boiling point: about 200-205 degrees Celsius.
4. density: about 1.474 g/cm.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide, insoluble in water.
6. Reactivity: sensitive to light, heat and oxygen, can occur substitution reaction, esterification reaction, etc.
Use:
1. As a drug intermediate: TFBA can be used to synthesize a variety of drugs, such as chemotherapeutic agents, anti-cancer drugs, etc.
2. As a dye intermediate: TFBA can be used to synthesize aromatic amide dyes with good dyeing properties.
3. for organic synthesis: TFBA can be used as a reagent and catalyst in organic synthesis, and participate in various organic synthesis reactions.
Method:
the common preparation method of TFBA is prepared by the substitution reaction of trifluoromethylbenzene. A common preparation method is to react trifluoromethylbenzene with bromoacetic acid under basic conditions to give 2,3, 6-trifluorophenylacetic acid.
Safety Information:
1. TFBA is less harmful to human body and environment, but it is still necessary to follow the correct safe operation method.
2. During use, avoid contact with skin, eyes and respiratory tract, and avoid inhaling dust or gas.
3. During operation, wear appropriate protective equipment, such as gloves, glasses and protective masks.
4. storage should be placed in a cool, dry and well ventilated place, away from fire and oxidant.
Please note that the relevant information of TFBA is for reference only. The specific operation and use should follow the laboratory safety regulations and chemical safety operation guidelines.
Nature:
1. Appearance: Colorless or yellow crystalline solid.
2. melting point: about 50-53 degrees Celsius.
3. Boiling point: about 200-205 degrees Celsius.
4. density: about 1.474 g/cm.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide, insoluble in water.
6. Reactivity: sensitive to light, heat and oxygen, can occur substitution reaction, esterification reaction, etc.
Use:
1. As a drug intermediate: TFBA can be used to synthesize a variety of drugs, such as chemotherapeutic agents, anti-cancer drugs, etc.
2. As a dye intermediate: TFBA can be used to synthesize aromatic amide dyes with good dyeing properties.
3. for organic synthesis: TFBA can be used as a reagent and catalyst in organic synthesis, and participate in various organic synthesis reactions.
Method:
the common preparation method of TFBA is prepared by the substitution reaction of trifluoromethylbenzene. A common preparation method is to react trifluoromethylbenzene with bromoacetic acid under basic conditions to give 2,3, 6-trifluorophenylacetic acid.
Safety Information:
1. TFBA is less harmful to human body and environment, but it is still necessary to follow the correct safe operation method.
2. During use, avoid contact with skin, eyes and respiratory tract, and avoid inhaling dust or gas.
3. During operation, wear appropriate protective equipment, such as gloves, glasses and protective masks.
4. storage should be placed in a cool, dry and well ventilated place, away from fire and oxidant.
Please note that the relevant information of TFBA is for reference only. The specific operation and use should follow the laboratory safety regulations and chemical safety operation guidelines.
Last Update：2024-04-09 15:17:51
Supplier List
Spot supply
Product Name: Atogepant Impurity 1 Visit Supplier Webpage Request for quotationCAS: 114152-23-7
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 2,3,6-Trifluorophenylacetic Acid Visit Supplier Webpage Request for quotation
CAS: 114152-23-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 114152-23-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Atogepant Impurity 1 Visit Supplier Webpage Request for quotationCAS: 114152-23-7
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Product Name: 2,3,6-Trifluorophenylacetic Acid Visit Supplier Webpage Request for quotation
CAS: 114152-23-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 114152-23-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History